Difference between revisions of "RIBOSE-15-BISPHOSPHATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5537 PWY-5537] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-15-BISPHOSPHATE RIBOSE-15-BISPHOSPHATE] == * smiles: ** C(C1(OC(C(C1O)O)OP([O-])([O-])=O...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5537 PWY-5537] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-15-BISPHOSPHATE RIBOSE-15-BISPHOSPHATE] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
+
** C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
+
 
* common name:
 
* common name:
−
** pyruvate fermentation to acetate V
+
** α-D-ribose 1,5-bisphosphate
 +
* inchi key:
 +
** InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J
 +
* molecular weight:
 +
** 306.059   
 
* Synonym(s):
 
* Synonym(s):
−
** acetate fermentation
+
** ribose-1,5-bisphosphate
−
** acetate:succinate CoA transferase/SCoAS cycle
+
−
** ASCT cycle
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN0-1401]]
−
* [[PYRUVDEH-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 7 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_2515]]
+
−
*** [[Tiso_gene_6983]]
+
−
*** [[Tiso_gene_17539]]
+
−
*** [[Tiso_gene_2693]]
+
−
*** [[Tiso_gene_9330]]
+
−
*** [[Tiso_gene_7519]]
+
−
*** [[Tiso_gene_19780]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[SUCCCOASYN-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_15846]]
+
−
*** [[Tiso_gene_11866]]
+
−
** 7 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5536 PWY-5536]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5536 PWY-5536]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33682}}
+
* LIGAND-CPD:
−
{{#set: taxonomic range=TAX-33154}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01151 C01151]
−
{{#set: common name=pyruvate fermentation to acetate V}}
+
* HMDB : HMDB11688
−
{{#set: common name=acetate fermentation|acetate:succinate CoA transferase/SCoAS cycle|ASCT cycle}}
+
* CHEBI:
−
{{#set: reaction found=2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68688 68688]
−
{{#set: total reaction=4}}
+
* BIGG : r15bp
−
{{#set: completion rate=50.0}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678980 70678980]
 +
{{#set: smiles=C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O}}
 +
{{#set: common name=α-D-ribose 1,5-bisphosphate}}
 +
{{#set: inchi key=InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J}}
 +
{{#set: molecular weight=306.059    }}
 +
{{#set: common name=ribose-1,5-bisphosphate}}
 +
{{#set: consumed by=RXN0-1401}}

Latest revision as of 19:27, 21 March 2018

Metabolite RIBOSE-15-BISPHOSPHATE

  • smiles:
    • C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O
  • common name:
    • α-D-ribose 1,5-bisphosphate
  • inchi key:
    • InChIKey=AAAFZMYJJHWUPN-TXICZTDVSA-J
  • molecular weight:
    • 306.059
  • Synonym(s):
    • ribose-1,5-bisphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C1O)O)OP([O-])([O-])=O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RIBOSE-15-BISPHOSPHATE&oldid=41755"