Difference between revisions of "Tiso gene 3446"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] == * smiles: ** [CH](=O)C(C(C(C(CO)O)O)O)O * inchi key: ** InChIKey=GZCGUP...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15374 CPD-15374] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN] ==
−
* smiles:
+
* taxonomic range:
−
** [CH](=O)C(C(C(C(CO)O)O)O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
−
** InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** aldehydo-D-glucose
+
** 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)
−
* molecular weight:
+
−
** 180.157   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal
+
** light-dependent aerobic 3,8-divinyl-chlorophyllide a biosynthesis I
−
** linear D-glucose
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-14408]]
+
* '''9''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[RXN1F-20]]
−
== Reaction(s) of unknown directionality ==
+
** [[RXN0-1461]]
 +
** [[RXN-5282]]
 +
** [[RXN-5283]]
 +
** [[RXN-5284]]
 +
** [[RXN-5285]]
 +
** [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 +
** [[UROGENDECARBOX-RXN]]
 +
** [[PROTOPORGENOXI-RXN]]
 +
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2763}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107526 107526]
+
{{#set: taxonomic range=TAX-33682}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42758 42758]
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: smiles=[CH](=O)C(C(C(C(CO)O)O)O)O}}
+
{{#set: common name=3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)}}
−
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-SLPGGIOYSA-N}}
+
{{#set: common name=light-dependent aerobic 3,8-divinyl-chlorophyllide a biosynthesis I}}
−
{{#set: common name=aldehydo-D-glucose}}
+
{{#set: reaction found=9}}
−
{{#set: molecular weight=180.157    }}
+
{{#set: reaction not found=0}}
−
{{#set: common name=(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal|linear D-glucose}}
+
−
{{#set: consumed by=RXN-14408}}
+

Revision as of 16:23, 10 January 2018

Pathway CHLOROPHYLL-SYN

  • taxonomic range:
  • common name:
    • 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent)
  • Synonym(s):
    • light-dependent aerobic 3,8-divinyl-chlorophyllide a biosynthesis I

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3446&oldid=12711"