Difference between revisions of "CPD-14873"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19919 == * right end position: ** 1776 * transcription direction: ** POSITIVE * left end position: ** 166 * centisome position: ** 8.636837...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * smiles: ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) * common name: ** 3-amino-4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) |
− | * | + | * common name: |
− | ** | + | ** 3-amino-4-hydroxybenzoate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 152.129 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-amino-4-hydroxybenzoic acid | ||
+ | ** 3,4-AHBA | ||
+ | ** 5-amino saliciylic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[RXN-13870]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54694272 54694272] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.58593.html 58593] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60005 60005] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C12115 C12115] | ||
+ | {{#set: smiles=C(=O)([O-])C1(C=C(N)C(O)=CC=1)}} | ||
+ | {{#set: common name=3-amino-4-hydroxybenzoate}} | ||
+ | {{#set: inchi key=InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=152.129 }} | ||
+ | {{#set: common name=3-amino-4-hydroxybenzoic acid|3,4-AHBA|5-amino saliciylic acid}} | ||
+ | {{#set: reversible reaction associated=RXN-13870}} |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPD-14873
- smiles:
- C(=O)([O-])C1(C=C(N)C(O)=CC=1)
- common name:
- 3-amino-4-hydroxybenzoate
- inchi key:
- InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M
- molecular weight:
- 152.129
- Synonym(s):
- 3-amino-4-hydroxybenzoic acid
- 3,4-AHBA
- 5-amino saliciylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C1(C=C(N)C(O)=CC=1)" cannot be used as a page name in this wiki.