Difference between revisions of "Short-Mannan"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * smiles: ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_12019 == * Synonym(s): == Reactions associated == * 3.1.4.11-RXN ** pantograph-esiliculosus * RXN-13334 ** pantograph-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12019 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[3.1.4.11-RXN]] |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | == | + | * [[RXN-13334]] |
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6367]] | ||
+ | * [[PWY-6351]] | ||
+ | * [[PWY-7039]] | ||
+ | * [[LIPASYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.1.4.11-RXN|RXN-13334}} | |
− | + | {{#set: pathway associated=PWY-6367|PWY-6351|PWY-7039|LIPASYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 17:23, 10 January 2018
Gene Tiso_gene_12019
- Synonym(s):