Difference between revisions of "Tiso gene 4419"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * common name: ** 3-amino-4-hydr...")
(Created page with "Category:Gene == Gene Tiso_gene_4419 == * right end position: ** 14296 * transcription direction: ** POSITIVE * left end position: ** 11596 * centisome position: ** 63.536...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] ==
+
== Gene Tiso_gene_4419 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)C1(=CC=C(O)C(N)=C1)
+
** 14296
−
* common name:
+
* transcription direction:
−
** 3-amino-4-hydroxybenzaldehyde
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N
+
** 11596
−
* molecular weight:
+
* centisome position:
−
** 137.138    
+
** 63.536243    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-13181]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-13871]]
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-13182]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[SIALATE-O-ACETYLESTERASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=14296}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11521082 11521082]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=11596}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78237 78237]
+
{{#set: centisome position=63.536243   }}
−
{{#set: smiles=[CH](=O)C1(=CC=C(O)C(N)=C1)}}
+
{{#set: reaction associated=RXN-13181|RXN-13182|SIALATE-O-ACETYLESTERASE-RXN}}
−
{{#set: common name=3-amino-4-hydroxybenzaldehyde}}
+
−
{{#set: inchi key=InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=137.138   }}
+
−
{{#set: reversible reaction associated=RXN-13871}}
+

Latest revision as of 19:28, 21 March 2018

Gene Tiso_gene_4419

  • right end position:
    • 14296
  • transcription direction:
    • POSITIVE
  • left end position:
    • 11596
  • centisome position:
    • 63.536243
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4419&oldid=41863"