Difference between revisions of "Thiols"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * common name: ** L-tryptopha...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiols Thiols] == * common name: ** a thiol * Synonym(s): ** a mercaptan == Reaction(s) known...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiols Thiols] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a thiol |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a mercaptan |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16226]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[UBIQUITIN-THIOLESTERASE-RXN]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a thiol}} | |
| − | + | {{#set: common name=a mercaptan}} | |
| − | + | {{#set: consumed by=RXN-16226}} | |
| − | + | {{#set: produced by=UBIQUITIN-THIOLESTERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
| − | {{#set: produced by= | + | |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite Thiols
- common name:
- a thiol
- Synonym(s):
- a mercaptan
