Difference between revisions of "CHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8689 == * Synonym(s): == Reactions associated == * Reaction: 3.2.1.39-RXN ** Source: orthology-esiliculosus == Pathways associated...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8689 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
 +
* smiles:
 +
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 +
* common name:
 +
** chlorophyllide a
 +
* molecular weight:
 +
** 612.967   
 
* Synonym(s):
 
* Synonym(s):
 +
** chlorophyllide
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[3.2.1.39-RXN]]
+
* [[RXN-7663]]
** Source: [[orthology-esiliculosus]]
+
* [[RXN-7676]]
== Pathways associated ==
+
* [[RXN-13398]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[RXN-5286]]
 +
== Reaction(s) of unknown directionality ==
 +
* [[RXN1F-10]]
 +
* [[RXN1F-66]]
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=3.2.1.39-RXN}}
+
* CAS : 14897-06-4
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=chlorophyllide a}}
 +
{{#set: molecular weight=612.967    }}
 +
{{#set: common name=chlorophyllide}}
 +
{{#set: consumed by=RXN-7663|RXN-7676|RXN-13398}}
 +
{{#set: produced by=RXN-5286}}
 +
{{#set: reversible reaction associated=RXN1F-10|RXN1F-66}}

Latest revision as of 19:29, 21 March 2018

Metabolite CHLOROPHYLLIDE-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • chlorophyllide a
  • molecular weight:
    • 612.967
  • Synonym(s):
    • chlorophyllide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.