Difference between revisions of "PWY-6308"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * common name: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6308 PWY-6308] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-28890 TAX-2...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6308 PWY-6308] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-28890 TAX-28890] |
* common name: | * common name: | ||
| − | ** | + | ** L-cysteine biosynthesis II (tRNA-dependent) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-cysteinyl-tRNAcys biosynthesis via tRNA modification |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[RXN-16637]] | |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Tiso_gene_7443]] | ||
| + | *** [[Tiso_gene_14300]] | ||
| + | *** [[Tiso_gene_13800]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10718 RXN-10718] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10719 RXN-10719] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-28890}} | |
| − | + | {{#set: common name=L-cysteine biosynthesis II (tRNA-dependent)}} | |
| − | + | {{#set: common name=L-cysteinyl-tRNAcys biosynthesis via tRNA modification}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=3}} |
| − | {{#set: common name= | + | {{#set: completion rate=33.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:29, 21 March 2018
Pathway PWY-6308
- taxonomic range:
- common name:
- L-cysteine biosynthesis II (tRNA-dependent)
- Synonym(s):
- L-cysteinyl-tRNAcys biosynthesis via tRNA modification
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-16637
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
