Difference between revisions of "TRNA-uridine55"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-METHYL-MALONYL-COA D-METHYL-MALONYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine55 tRNA-uridine55] == * common name: ** a uridine55 in tRNA * Synonym(s): ** a tRNA...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-METHYL-MALONYL-COA D-METHYL-MALONYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine55 tRNA-uridine55] ==
−
* smiles:
+
−
** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O
+
 
* common name:
 
* common name:
−
** (S)-methylmalonyl-CoA
+
** a uridine55 in tRNA
−
* inchi key:
+
−
** InChIKey=MZFOKIKEPGUZEN-IBNUZSNCSA-I
+
−
* molecular weight:
+
−
** 862.568   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-methylmalonyl-CoA
+
** a tRNA uridine55
−
** methyl-malonyl-coenzyme A
+
−
** CH3-malonyl-CoA
+
−
** (2S)-methyl-malonyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11839]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 104809-02-1
+
{{#set: common name=a uridine55 in tRNA}}
−
* BIGG : mmcoa__S
+
{{#set: common name=a tRNA uridine55}}
−
* PUBCHEM:
+
{{#set: consumed by=RXN-11839}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266561 45266561]
+
−
* HMDB : HMDB01269
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00683 C00683]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57327 57327]
+
−
* METABOLIGHTS : MTBLC57327
+
−
{{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O}}
+
−
{{#set: common name=(S)-methylmalonyl-CoA}}
+
−
{{#set: inchi key=InChIKey=MZFOKIKEPGUZEN-IBNUZSNCSA-I}}
+
−
{{#set: molecular weight=862.568    }}
+
−
{{#set: common name=D-methylmalonyl-CoA|methyl-malonyl-coenzyme A|CH3-malonyl-CoA|(2S)-methyl-malonyl-CoA}}
+
−
{{#set: reversible reaction associated=PROPIONYL-COA-CARBOXY-RXN}}
+

Latest revision as of 20:30, 21 March 2018

Metabolite tRNA-uridine55

  • common name:
    • a uridine55 in tRNA
  • Synonym(s):
    • a tRNA uridine55

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRNA-uridine55&oldid=41987"