Difference between revisions of "PWY-5663"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * common name: ** L-ornithin...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5663 PWY-5663] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5663 PWY-5663] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-68336] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] | ||
* common name: | * common name: | ||
| − | ** | + | ** tetrahydrobiopterin biosynthesis I |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | * | + | * [[GTP-CYCLOHYDRO-I-RXN]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_12736]] |
| − | + | ** 3 reconstruction source(s) associated: | |
| − | * [[ | + | *** [[orthology-creinhardtii]] |
| − | * [[ | + | *** [[orthology-synechocystis]] |
| − | == Reaction(s) | + | *** [[orthology-esiliculosus]] |
| − | * [ | + | == Reaction(s) not found == |
| − | + | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.12-RXN 4.2.3.12-RXN] | |
| − | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8853 RXN-8853] | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33682}} | |
| − | + | {{#set: taxonomic range=TAX-68336}} | |
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: taxonomic range=TAX-1117}} | |
| − | + | {{#set: common name=tetrahydrobiopterin biosynthesis I}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:31, 21 March 2018
Pathway PWY-5663
- taxonomic range:
- common name:
- tetrahydrobiopterin biosynthesis I
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- GTP-CYCLOHYDRO-I-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
