Difference between revisions of "HOMOSER-METSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] == * smiles: ** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?ob...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** 6-cis, 3-oxo-tridecenoyl-CoA
+
** L-methionine biosynthesis I
−
* inchi key:
+
−
** InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J
+
−
* molecular weight:
+
−
** 971.802   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 6Z, 3-oxo-tridecenoyl-CoA
+
** L-methionine biosynthesis from L-homoserine
 +
** L-methionine biosynthesis by transsulfuration
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-14774]]
+
'''4''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[HOMOCYSMET-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_1602]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[HOMOCYSMETB12-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1602]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3732]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-15131]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3732]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HOMSUCTRAN-RXN HOMSUCTRAN-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657308 90657308]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
−
{{#set: smiles=CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: common name=6-cis, 3-oxo-tridecenoyl-CoA}}
+
{{#set: common name=L-methionine biosynthesis I}}
−
{{#set: inchi key=InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J}}
+
{{#set: common name=L-methionine biosynthesis from L-homoserine|L-methionine biosynthesis by transsulfuration}}
−
{{#set: molecular weight=971.802    }}
+
{{#set: reaction found=4}}
−
{{#set: common name=6Z, 3-oxo-tridecenoyl-CoA}}
+
{{#set: total reaction=5}}
−
{{#set: consumed by=RXN-14774}}
+
{{#set: completion rate=80.0}}

Latest revision as of 19:31, 21 March 2018

Pathway HOMOSER-METSYN-PWY

  • taxonomic range:
  • common name:
    • L-methionine biosynthesis I
  • Synonym(s):
    • L-methionine biosynthesis from L-homoserine
    • L-methionine biosynthesis by transsulfuration

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HOMOSER-METSYN-PWY&oldid=42092"