|
|
| Line 1: |
Line 1: |
| − | [[Category:Reaction]] | + | [[Category:Metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLHOMOCYSTEINASE-RXN ADENOSYLHOMOCYSTEINASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == |
| − | * direction: | + | * smiles: |
| − | ** REVERSIBLE | + | ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O |
| | * common name: | | * common name: |
| − | ** adenosylhomocysteinase_1 | + | ** γ-L-glutamyl-glycylglycine |
| − | * ec number: | + | * inchi key: |
| − | ** [http://enzyme.expasy.org/EC/3.3.1.1 EC-3.3.1.1] | + | ** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M |
| | + | * molecular weight: |
| | + | ** 260.226 |
| | * Synonym(s): | | * Synonym(s): |
| | + | ** γ-L-Glu-Gly-Gly |
| | | | |
| − | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
| − | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
| − | ** 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[HOMO-CYS]][c] '''+''' 1 [[ADENOSINE]][c]
| + | * [[RXN-18092]] |
| − | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
| − | ** 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H2O[c] '''<=>''' 1 L-homocysteine[c] '''+''' 1 adenosine[c]
| + | |
| − | | + | |
| − | == Genes associated with this reaction == | + | |
| − | Genes have been associated with this reaction based on different elements listed below.
| + | |
| − | * Gene: [[Tiso_gene_14191]] | + | |
| − | ** Source: [[annotation-in-silico_annotation]]
| + | |
| − | *** Assignment: EC-NUMBER
| + | |
| − | ** Source: [[annotation-experimental_annotation]]
| + | |
| − | *** Assignment: EC-NUMBER
| + | |
| − | ** Source: [[orthology-athaliana]]
| + | |
| − | ** Source: [[orthology-synechocystis]]
| + | |
| − | ** Source: [[orthology-esiliculosus]]
| + | |
| − | ** Source: [[orthology-creinhardtii]]
| + | |
| − | == Pathways == | + | |
| − | * [[METHIONINE-DEG1-PWY]], L-methionine degradation I (to L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-DEG1-PWY METHIONINE-DEG1-PWY]
| + | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
| − | * [[PWY-5041]], S-adenosyl-L-methionine cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5041 PWY-5041]
| + | |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
| − | == Reconstruction information ==
| + | |
| − | * Category: [[orthology]]
| + | |
| − | ** Source: [[orthology-athaliana]]
| + | |
| − | *** Tool: [[pantograph]]
| + | |
| − | ** Source: [[orthology-creinhardtii]]
| + | |
| − | *** Tool: [[pantograph]]
| + | |
| − | ** Source: [[orthology-synechocystis]]
| + | |
| − | *** Tool: [[pantograph]]
| + | |
| − | ** Source: [[orthology-esiliculosus]]
| + | |
| − | *** Tool: [[pantograph]]
| + | |
| − | * Category: [[manual]]
| + | |
| − | ** Source: [[manual-primary_network]]
| + | |
| − | * Category: [[annotation]]
| + | |
| − | ** Source: [[annotation-in-silico_annotation]]
| + | |
| − | *** Tool: [[pathwaytools]]
| + | |
| − | ** Source: [[annotation-experimental_annotation]]
| + | |
| − | *** Tool: [[pathwaytools]]
| + | |
| | == External links == | | == External links == |
| − | * RHEA:
| + | {{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}} |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21708 21708]
| + | {{#set: common name=γ-L-glutamyl-glycylglycine}} |
| − | * LIGAND-RXN:
| + | {{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00192 R00192]
| + | {{#set: molecular weight=260.226 }} |
| − | * UNIPROT:
| + | {{#set: common name=γ-L-Glu-Gly-Gly}} |
| − | ** [http://www.uniprot.org/uniprot/P10760 P10760]
| + | {{#set: produced by=RXN-18092}} |
| − | ** [http://www.uniprot.org/uniprot/P10819 P10819]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P23526 P23526]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P28183 P28183]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P50250 P50250]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P60176 P60176]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q58783 Q58783]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O23255 O23255]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O27673 O27673]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O29376 O29376]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O28279 O28279]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P51893 P51893]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P50245 P50245]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P26799 P26799]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P35007 P35007]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P39954 P39954]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P50252 P50252]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P50249 P50249]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P74008 P74008]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P32112 P32112]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9UG84 Q9UG84]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q01781 Q01781]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P27604 P27604]
| + | |
| − | {{#set: direction=REVERSIBLE}}
| + | |
| − | {{#set: common name=adenosylhomocysteinase_1}} | + | |
| − | {{#set: ec number=EC-3.3.1.1}}
| + | |
| − | {{#set: gene associated=Tiso_gene_14191}} | + | |
| − | {{#set: in pathway=METHIONINE-DEG1-PWY|PWY-5041}}
| + | |
| − | {{#set: reconstruction category=orthology|manual|annotation}} | + | |
| − | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} | + | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |
