Difference between revisions of "CPD-14926"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17355 CPD-17355] == * common name: ** a [glycerolipid]-docosahexaenoate * Synonym(s): ** a...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * common name: ** phyte...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17355 CPD-17355] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] ==
 +
* smiles:
 +
** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
 
* common name:
 
* common name:
−
** a [glycerolipid]-docosahexaenoate
+
** phytenal
 +
* inchi key:
 +
** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
 +
* molecular weight:
 +
** 294.52   
 
* Synonym(s):
 
* Synonym(s):
−
** a [glycerolipid]-docosahexaenoic acid
+
** 2E-phytenal
−
** a [glycerolipid]-DHA
+
** 3,7,11,15-tetramethyl-2E-hexadecenal
−
** a [glycerolipid]-all-cis-docosa-4,7,10,13,16,19-hexaenoate
+
−
** a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
+
−
** a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
+
−
** a docosahexaenoyl-[glycerolipid]
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16138]]
+
* [[RXN66-479]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-478]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-16103]]
 
 
== External links  ==
 
== External links  ==
−
{{#set: common name=a [glycerolipid]-docosahexaenoate}}
+
* LIPID_MAPS : LMPR0104010025
−
{{#set: common name=a [glycerolipid]-docosahexaenoic acid|a [glycerolipid]-DHA|a [glycerolipid]-all-cis-docosa-4,7,10,13,16,19-hexaenoate|a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|a [glycerolipid]-(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate|a docosahexaenoyl-[glycerolipid]}}
+
* PUBCHEM:
−
{{#set: consumed by=RXN-16138}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764]
−
{{#set: reversible reaction associated=RXN-16103}}
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}}
 +
{{#set: common name=phytenal}}
 +
{{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}}
 +
{{#set: molecular weight=294.52    }}
 +
{{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}}
 +
{{#set: consumed by=RXN66-479}}
 +
{{#set: produced by=RXN66-478}}

Latest revision as of 19:31, 21 March 2018

Metabolite CPD-14926

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
  • common name:
    • phytenal
  • inchi key:
    • InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
  • molecular weight:
    • 294.52
  • Synonym(s):
    • 2E-phytenal
    • 3,7,11,15-tetramethyl-2E-hexadecenal

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMPR0104010025
  • PUBCHEM:
"CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-14926&oldid=42146"