Difference between revisions of "CPD-724"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)C...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** adenosylcobalamin salvage from cobinamide II
+
** 6α-hydroxy-castasterone
 +
* inchi key:
 +
** InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
 +
* molecular weight:
 +
** 466.7   
 
* Synonym(s):
 
* Synonym(s):
** vitamin B12 biosynthesis
+
** hydroxydeoxocastasterone
 +
** 6α-hydroxy-6-deoxocastasterone
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''7''' reactions in the full pathway
+
* [[RXN-779]]
* [[BTUR2-RXN]]
+
== Reaction(s) known to produce the compound ==
** 1 associated gene(s):
+
* [[RXN-778]]
*** [[Tiso_gene_6190]]
+
== Reaction(s) of unknown directionality ==
** 1 reconstruction source(s) associated:
+
*** [[orthology-esiliculosus]]
+
* [[RXN-8770]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_16271]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=COBALAMIN5PSYN-RXN COBALAMIN5PSYN-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=COBINPGUANYLYLTRANS-RXN COBINPGUANYLYLTRANS-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=DMBPPRIBOSYLTRANS-RXN DMBPPRIBOSYLTRANS-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=R346-RXN R346-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6261 RXN-6261]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2157}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15542699 15542699]
{{#set: common name=adenosylcobalamin salvage from cobinamide II}}
+
* CHEBI:
{{#set: common name=vitamin B12 biosynthesis}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20760 20760]
{{#set: reaction found=2}}
+
* LIGAND-CPD:
{{#set: total reaction=7}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15803 C15803]
{{#set: completion rate=29.0}}
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=6α-hydroxy-castasterone}}
 +
{{#set: inchi key=InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N}}
 +
{{#set: molecular weight=466.7    }}
 +
{{#set: common name=hydroxydeoxocastasterone|6α-hydroxy-6-deoxocastasterone}}
 +
{{#set: consumed by=RXN-779}}
 +
{{#set: produced by=RXN-778}}

Latest revision as of 19:32, 21 March 2018

Metabolite CPD-724

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6α-hydroxy-castasterone
  • inchi key:
    • InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
  • molecular weight:
    • 466.7
  • Synonym(s):
    • hydroxydeoxocastasterone
    • 6α-hydroxy-6-deoxocastasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.