Difference between revisions of "RXN-11410"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] == * smiles: ** C([O-])(=O)CC1(=CNC2(C=CC=CC1=2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11410 RXN-11410] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11410 RXN-11410] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[DGTP]][c] '''+''' 2 [[CPD-12377]][c] '''=>''' 1 [[CPD0-1905]][c] '''+''' 1 [[WATER]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 dGTP[c] '''+''' 2 hydroxyl radical[c] '''=>''' 1 8-oxo-dGTP[c] '''+''' 1 H2O[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | + | == Pathways == | |
| + | * [[PWY-6502]], oxidized GTP and dGTP detoxification: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6502 PWY-6502] | ||
| + | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=PWY-6502}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:33, 21 March 2018
Contents
Reaction RXN-11410
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 dGTP[c] + 2 hydroxyl radical[c] => 1 8-oxo-dGTP[c] + 1 H2O[c]
Genes associated with this reaction
Pathways
- PWY-6502, oxidized GTP and dGTP detoxification: PWY-6502
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
