Difference between revisions of "TROPINONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME256 RME256] == * direction: ** LEFT-TO-RIGHT * common name: ** RME256 * Synonym(s): == Reaction...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == * smiles: ** C[N+]1(C2(CCC1CC(=O)C2)) * common name: ** tropinone * inc...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME256 RME256] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C[N+]1(C2(CCC1CC(=O)C2))
 
* common name:
 
* common name:
−
** RME256
+
** tropinone
 +
* inchi key:
 +
** InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
 +
* molecular weight:
 +
** 140.205   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 0.56 [[ATP]][c] '''+''' 0.34 [[GTP]][c] '''+''' 0.34 [[CTP]][c] '''+''' 1.4 [[WATER]][c] '''+''' 0.16 [[UTP]][c] '''=>''' 0.4 [[ADP]][c] '''+''' 1.0 [[PPI]][c] '''+''' 0.4 [[PROTON]][c] '''+''' 0.4 [[Pi]][c] '''+''' 1.0 [[RNA-Holder]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[TROPINE-DEHYDROGENASE-RXN]]
−
** 0.56 ATP[c] '''+''' 0.34 GTP[c] '''+''' 0.34 CTP[c] '''+''' 1.4 H2O[c] '''+''' 0.16 UTP[c] '''=>''' 0.4 ADP[c] '''+''' 1.0 diphosphate[c] '''+''' 0.4 H+[c] '''+''' 0.4 phosphate[c] '''+''' 1.0 RNA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=RME256}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=698003 698003]
−
{{#set: in pathway=}}
+
* CAS : 532-24-1
−
{{#set: reconstruction category=manual}}
+
* NCI:
−
{{#set: reconstruction source=manual-primary_network}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=118012 118012]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00783 C00783]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.2789160.html 2789160]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57851 57851]
 +
{{#set: smiles=C[N+]1(C2(CCC1CC(=O)C2))}}
 +
{{#set: common name=tropinone}}
 +
{{#set: inchi key=InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O}}
 +
{{#set: molecular weight=140.205    }}
 +
{{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}}

Latest revision as of 20:33, 21 March 2018

Metabolite TROPINONE

  • smiles:
    • C[N+]1(C2(CCC1CC(=O)C2))
  • common name:
    • tropinone
  • inchi key:
    • InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
  • molecular weight:
    • 140.205
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[N+]1(C2(CCC1CC(=O)C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TROPINONE&oldid=42345"