Difference between revisions of "TROPINONE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME256 RME256] == * direction: ** LEFT-TO-RIGHT * common name: ** RME256 * Synonym(s): == Reaction...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == * smiles: ** C[N+]1(C2(CCC1CC(=O)C2)) * common name: ** tropinone * inc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == |
− | * | + | * smiles: |
− | ** | + | ** C[N+]1(C2(CCC1CC(=O)C2)) |
* common name: | * common name: | ||
− | ** | + | ** tropinone |
+ | * inchi key: | ||
+ | ** InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O | ||
+ | * molecular weight: | ||
+ | ** 140.205 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[TROPINE-DEHYDROGENASE-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=698003 698003] |
− | {{#set: | + | * CAS : 532-24-1 |
− | {{#set: | + | * NCI: |
− | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=118012 118012] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00783 C00783] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.2789160.html 2789160] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57851 57851] | ||
+ | {{#set: smiles=C[N+]1(C2(CCC1CC(=O)C2))}} | ||
+ | {{#set: common name=tropinone}} | ||
+ | {{#set: inchi key=InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O}} | ||
+ | {{#set: molecular weight=140.205 }} | ||
+ | {{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}} |
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite TROPINONE
- smiles:
- C[N+]1(C2(CCC1CC(=O)C2))
- common name:
- tropinone
- inchi key:
- InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
- molecular weight:
- 140.205
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]1(C2(CCC1CC(=O)C2))" cannot be used as a page name in this wiki.