Difference between revisions of "2.3.1.41-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6991 CPD-6991] == * smiles: ** C3(C=CC(C2(OC1(=CC(=CC(=C1C(C2)=O)O)[O-])))=CC=3) * common n...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.41-RXN 2.3.1.41-RXN] == * direction: ** REVERSIBLE * common name: ** 3-oxoacyl-synthase * ec...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.41-RXN 2.3.1.41-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
− | ** | + | ** 3-oxoacyl-synthase |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[ACYL-ACP]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[B-KETOACYL-ACP]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 an acyl-[acyl-carrier protein][c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''<=>''' 1 a 3-oxoacyl-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9885]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_15991]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5939]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_19302]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_13083]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_14485]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02768 R02768] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=3-oxoacyl-synthase}} | |
− | * LIGAND- | + | {{#set: ec number=EC-2.3.1.41}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Tiso_gene_9885|Tiso_gene_15991|Tiso_gene_5939|Tiso_gene_19302|Tiso_gene_13083|Tiso_gene_14485}} |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:33, 21 March 2018
Contents
Reaction 2.3.1.41-RXN
- direction:
- REVERSIBLE
- common name:
- 3-oxoacyl-synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACYL-ACP[c] + 1 MALONYL-ACP[c] + 1 PROTON[c] <=> 1 B-KETOACYL-ACP[c] + 1 ACP[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 an acyl-[acyl-carrier protein][c] + 1 a malonyl-[acp][c] + 1 H+[c] <=> 1 a 3-oxoacyl-[acp][c] + 1 a holo-[acyl-carrier protein][c] + 1 CO2[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9885
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_15991
- Source: orthology-esiliculosus
- Gene: Tiso_gene_5939
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19302
- Source: orthology-esiliculosus
- Gene: Tiso_gene_13083
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_14485
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: