Difference between revisions of "Tiso gene 3686"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)N(C)C(=O)N2)) * common name: ** 1,7-d...") |
(Created page with "Category:Gene == Gene Tiso_gene_3686 == * Synonym(s): == Reactions associated == * Reaction: TYROSINE-DECARBOXYLASE-RXN ** Source: orthology-esiliculosus == Pathw...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_3686 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[TYROSINE-DECARBOXYLASE-RXN]] | |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | == | + | == Pathways associated == |
| + | * [[PWY-3581]] | ||
| + | * [[PWY-6133]] | ||
| + | * [[PWY-5254]] | ||
| + | * [[PWY-7826]] | ||
| + | * [[PWY-7297]] | ||
| + | * [[PWY-5474]] | ||
| + | * [[PWY-6802]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=TYROSINE-DECARBOXYLASE-RXN}} | |
| − | + | {{#set: pathway associated=PWY-3581|PWY-6133|PWY-5254|PWY-7826|PWY-7297|PWY-5474|PWY-6802}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:34, 21 March 2018
Gene Tiso_gene_3686
- Synonym(s):
Reactions associated
- Reaction: TYROSINE-DECARBOXYLASE-RXN
- Source: orthology-esiliculosus
