Difference between revisions of "PLASMENYLCHOLINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11870 == * Synonym(s): == Reactions associated == * 3.1.3.16-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == * smiles: ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) * inchi key: ** InChIKey=PX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] == |
+ | * smiles: | ||
+ | ** C1(=NC2(=C(NC1)N=C(N)NC(=O)2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** 7,8-dihydropterin | ||
+ | * molecular weight: | ||
+ | ** 165.154 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** dihydropterin | ||
+ | ** H2-pterin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-15261]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65260 65260] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.58752.html 58752] | ||
+ | {{#set: smiles=C1(=NC2(=C(NC1)N=C(N)NC(=O)2))}} | ||
+ | {{#set: inchi key=InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=7,8-dihydropterin}} | ||
+ | {{#set: molecular weight=165.154 }} | ||
+ | {{#set: common name=dihydropterin|H2-pterin}} | ||
+ | {{#set: consumed by=RXN-15261}} |
Revision as of 16:24, 10 January 2018
Contents
Metabolite CPD0-1718
- smiles:
- C1(=NC2(=C(NC1)N=C(N)NC(=O)2))
- inchi key:
- InChIKey=PXZWKVIXSKSCFR-UHFFFAOYSA-N
- common name:
- 7,8-dihydropterin
- molecular weight:
- 165.154
- Synonym(s):
- dihydropterin
- H2-pterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links