Difference between revisions of "RXN-17731"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17731 RXN-17731] == * direction: ** LEFT-TO-RIGHT * common name: ** ethanolaminephosphotransfer...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17731 RXN-17731] ==
* smiles:
+
* direction:
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** (22S,24R)-22-hydroxy-5α-ergostan-3-one
+
** ethanolaminephosphotransferase
* inchi key:
+
* ec number:
** InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N
+
** [http://enzyme.expasy.org/EC/2.7.8.1 EC-2.7.8.1]
* molecular weight:
+
** 416.686   
+
 
* Synonym(s):
 
* Synonym(s):
** (22S)-22-hydroxy-5α-campestan-3-one
 
** (22α)-hydroxy-5α-campestan-3-one
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-4230]]
+
** 1 [[CDP-ETHANOLAMINE]][c] '''+''' 1 [[1-Alkyl-2-acyl-glycerol]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[1-Alkyl-2-acyl-glycerol-P-Etn]][c] '''+''' 1 [[CMP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 CDP-ethanolamine[c] '''+''' 1 a 2-acyl-1-alkyl-sn-glycerol[c] '''=>''' 1 H+[c] '''+''' 1 a plasmanylethalomine[c] '''+''' 1 CMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13392]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782]
 +
** '''7''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01031117
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=ethanolaminephosphotransferase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878488 46878488]
+
{{#set: ec number=EC-2.7.8.1}}
* HMDB : HMDB12112
+
{{#set: gene associated=Tiso_gene_13392}}
* CHEBI:
+
{{#set: in pathway=PWY-7782}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59411 59411]
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C15797 C15797]
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=(22S,24R)-22-hydroxy-5α-ergostan-3-one}}
+
{{#set: inchi key=InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N}}
+
{{#set: molecular weight=416.686    }}
+
{{#set: common name=(22S)-22-hydroxy-5α-campestan-3-one|(22α)-hydroxy-5α-campestan-3-one}}
+
{{#set: produced by=RXN-4230}}
+

Latest revision as of 19:35, 21 March 2018

Reaction RXN-17731

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ethanolaminephosphotransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7782, plasmalogen biosynthesis: PWY-7782
    • 7 reactions found over 16 reactions in the full pathway

Reconstruction information

External links