Difference between revisions of "COPROPORPHYRINOGEN I"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] == * smiles: ** CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRINOGEN_I COPROPORPHYRINOGEN_I] == |
* smiles: | * smiles: | ||
| − | ** C(O)C( | + | ** CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5))) |
* common name: | * common name: | ||
| − | ** | + | ** coproporphyrinogen I |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 656.734 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-10642]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849147 20849147] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.20171594.html 20171594] |
| + | * HMDB : HMDB02158 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62631 62631] |
| − | {{#set: smiles=C(O)C( | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05768 C05768] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))}} |
| − | {{#set: molecular weight= | + | {{#set: common name=coproporphyrinogen I}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J}} |
| − | + | {{#set: molecular weight=656.734 }} | |
| + | {{#set: reversible reaction associated=RXN-10642}} | ||
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite COPROPORPHYRINOGEN_I
- smiles:
- CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))
- common name:
- coproporphyrinogen I
- inchi key:
- InChIKey=WIUGGJKHYQIGNH-UHFFFAOYSA-J
- molecular weight:
- 656.734
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=C2(CC5(=C(CCC([O-])=O)C(C)=C(CC4(=C(CCC([O-])=O)C(C)=C(CC3(=C(CCC([O-])=O)C(C)=C(CC(=C(CCC([O-])=O)1)N2)N3))N4))N5)))" cannot be used as a page name in this wiki.
