Difference between revisions of "RXN-14214"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14214 RXN-14214] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * Synonym(s): == React...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14214 RXN-14214] ==
* smiles:
+
* direction:
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** 5-dehydroavenasterol
+
** ORF
* inchi key:
+
** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
+
* molecular weight:
+
** 410.682   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-4210]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[DATP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
* [[RXN-4209]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 dATP[c] '''+''' 1 H2O[c] '''=>''' 1 dADP[c] '''+''' 1 H+[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263331 44263331]
+
{{#set: common name=ORF}}
* HMDB : HMDB06852
+
{{#set: gene associated=Tiso_gene_20236|Tiso_gene_12899}}
* CHEBI:
+
{{#set: in pathway=}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097]
+
{{#set: reconstruction category=orthology|annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=5-dehydroavenasterol}}
+
{{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}}
+
{{#set: molecular weight=410.682    }}
+
{{#set: consumed by=RXN-4210}}
+
{{#set: produced by=RXN-4209}}
+

Latest revision as of 19:36, 21 March 2018

Reaction RXN-14214

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 dATP[c] + 1 H2O[c] => 1 dADP[c] + 1 H+[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links