Difference between revisions of "PWY-7003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == * smiles: ** CC(O)C([N+])C(=O)[O-] * common name: ** L-threonine * inchi key: ** In...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7003 PWY-7003] ==
−
* smiles:
+
* taxonomic range:
−
** CC(O)C([N+])C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** L-threonine
+
** glycerol degradation to butanol
−
* inchi key:
+
−
** InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N
+
−
* molecular weight:
+
−
** 119.12   
+
 
* Synonym(s):
 
* Synonym(s):
−
** T
 
−
** thr
 
−
** thre
 
−
** L-thr
 
−
** threonine
 
−
** 2-amino-3-hydroxybutyric acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[THREONINE--TRNA-LIGASE-RXN]]
+
'''8''' reactions found over '''10''' reactions in the full pathway
−
* [[RME144]]
+
* [[2PGADEHYDRAT-RXN]]
−
* [[RXN-14249]]
+
** 4 associated gene(s):
−
* [[RXN-8626]]
+
*** [[Tiso_gene_8720]]
−
* [[THREONINE-ALDOLASE-RXN]]
+
*** [[Tiso_gene_14718]]
−
* [[RXN-15122]]
+
*** [[Tiso_gene_5619]]
−
* [[THREODEHYD-RXN]]
+
*** [[Tiso_gene_13317]]
−
* [[THREDEHYD-RXN]]
+
** 7 reconstruction source(s) associated:
−
== Reaction(s) known to produce the compound ==
+
*** [[annotation-experimental_annotation]]
−
* [[THRESYN-RXN]]
+
*** [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[3PGAREARR-RXN]]
 +
** 16 associated gene(s):
 +
*** [[Tiso_gene_15048]]
 +
*** [[Tiso_gene_7201]]
 +
*** [[Tiso_gene_9922]]
 +
*** [[Tiso_gene_2841]]
 +
*** [[Tiso_gene_14530]]
 +
*** [[Tiso_gene_16754]]
 +
*** [[Tiso_gene_2365]]
 +
*** [[Tiso_gene_16271]]
 +
*** [[Tiso_gene_5468]]
 +
*** [[Tiso_gene_20311]]
 +
*** [[Tiso_gene_14664]]
 +
*** [[Tiso_gene_15391]]
 +
*** [[Tiso_gene_14212]]
 +
*** [[Tiso_gene_10516]]
 +
*** [[Tiso_gene_9923]]
 +
*** [[Tiso_gene_2667]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_20000]]
 +
*** [[Tiso_gene_235]]
 +
*** [[Tiso_gene_10646]]
 +
*** [[Tiso_gene_3344]]
 +
*** [[Tiso_gene_6766]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PEPDEPHOS-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18206]]
 +
*** [[Tiso_gene_14504]]
 +
*** [[Tiso_gene_974]]
 +
*** [[Tiso_gene_14505]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_3526]]
 +
*** [[Tiso_gene_18264]]
 +
*** [[Tiso_gene_3527]]
 +
*** [[Tiso_gene_18263]]
 +
*** [[Tiso_gene_12104]]
 +
*** [[Tiso_gene_14642]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PWY-6131]]
 +
** 0 associated gene:
 +
* [[PWY-6583]]
 +
** 0 associated gene:
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_19961]]
 +
*** [[Tiso_gene_20000]]
 +
*** [[Tiso_gene_19962]]
 +
*** [[Tiso_gene_10646]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 72-19-5
+
{{#set: taxonomic range=TAX-2}}
−
* BIGG : thr__L
+
{{#set: common name=glycerol degradation to butanol}}
−
* PUBCHEM:
+
{{#set: reaction found=8}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971019 6971019]
+
{{#set: total reaction=10}}
−
* HMDB : HMDB00167
+
{{#set: completion rate=80.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00188 C00188]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57926 57926]
+
−
* METABOLIGHTS : MTBLC57926
+
−
{{#set: smiles=CC(O)C([N+])C(=O)[O-]}}
+
−
{{#set: common name=L-threonine}}
+
−
{{#set: inchi key=InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N}}
+
−
{{#set: molecular weight=119.12    }}
+
−
{{#set: common name=T|thr|thre|L-thr|threonine|2-amino-3-hydroxybutyric acid}}
+
−
{{#set: consumed by=THREONINE--TRNA-LIGASE-RXN|RME144|RXN-14249|RXN-8626|THREONINE-ALDOLASE-RXN|RXN-15122|THREODEHYD-RXN|THREDEHYD-RXN}}
+
−
{{#set: produced by=THRESYN-RXN}}
+

Latest revision as of 19:37, 21 March 2018

Pathway PWY-7003

  • taxonomic range:
  • common name:
    • glycerol degradation to butanol
  • Synonym(s):

Reaction(s) found

8 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7003&oldid=42783"