Difference between revisions of "CPD-8608"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-3-methyladenines DNA-3-methyladenines] == * common name: ** an N3-methyladenine in DNA * Sy...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-3-methyladenines DNA-3-methyladenines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
 +
* smiles:
 +
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
 
* common name:
 
* common name:
** an N3-methyladenine in DNA
+
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
 +
* inchi key:
 +
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
 +
* molecular weight:
 +
** 442.724   
 
* Synonym(s):
 
* Synonym(s):
** a DNA with N3-methyladenine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5189]]
+
* [[RXN66-13]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-12]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an N3-methyladenine in DNA}}
+
* PUBCHEM:
{{#set: common name=a DNA with N3-methyladenine}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
{{#set: consumed by=RXN0-5189}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
 +
* HMDB : HMDB12159
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
 +
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
 +
{{#set: molecular weight=442.724    }}
 +
{{#set: consumed by=RXN66-13}}
 +
{{#set: produced by=RXN66-12}}

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-8608

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • common name:
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
  • inchi key:
    • InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
  • molecular weight:
    • 442.724
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.