Difference between revisions of "SUMO-peptides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUMO-peptides SUMO-peptides] == * common name: ** a mature small ubiquitin-like modifier (SUMO)...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUMO-peptides SUMO-peptides] ==
* smiles:
+
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
+
 
* common name:
 
* common name:
** GDP-β-L-fucose
+
** a mature small ubiquitin-like modifier (SUMO) peptide
* inchi key:
+
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
+
* molecular weight:
+
** 587.33   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.271-RXN]]
+
* [[3.4.22.68-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a mature small ubiquitin-like modifier (SUMO) peptide}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
+
{{#set: produced by=3.4.22.68-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
+
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
+
{{#set: common name=GDP-β-L-fucose}}
+
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
+
{{#set: molecular weight=587.33    }}
+
{{#set: produced by=1.1.1.271-RXN}}
+

Latest revision as of 19:38, 21 March 2018

Metabolite SUMO-peptides

  • common name:
    • a mature small ubiquitin-like modifier (SUMO) peptide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links