Difference between revisions of "Tiso gene 17027"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * common name: ** D-glutamate * inch...") |
(Created page with "Category:Gene == Gene Tiso_gene_17027 == * right end position: ** 3897 * transcription direction: ** POSITIVE * left end position: ** 2529 * centisome position: ** 63.7509...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17027 == |
− | * | + | * right end position: |
− | ** | + | ** 3897 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2529 |
− | * | + | * centisome position: |
− | ** | + | ** 63.750946 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3897}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2529}} | |
− | + | {{#set: centisome position=63.750946 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:39, 21 March 2018
Gene Tiso_gene_17027
- right end position:
- 3897
- transcription direction:
- POSITIVE
- left end position:
- 2529
- centisome position:
- 63.750946
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation