Difference between revisions of "Tiso gene 9852"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * c...") |
(Created page with "Category:Gene == Gene Tiso_gene_9852 == * right end position: ** 2903 * transcription direction: ** POSITIVE * left end position: ** 197 * centisome position: ** 2.1840355...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9852 == |
− | * | + | * right end position: |
− | ** | + | ** 2903 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 197 |
− | * | + | * centisome position: |
− | ** | + | ** 2.1840355 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[CARBODEHYDRAT-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN0-5224]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-241]] | ||
+ | * [[PWYQT-4429]] | ||
+ | * [[PWY-7117]] | ||
+ | * [[PWY-7115]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[CYANCAT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2903}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=197}} | |
− | + | {{#set: centisome position=2.1840355 }} | |
− | + | {{#set: reaction associated=CARBODEHYDRAT-RXN|RXN0-5224}} | |
− | + | {{#set: pathway associated=PWY-241|PWYQT-4429|PWY-7117|PWY-7115|PWY-6142|CYANCAT-PWY}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:40, 21 March 2018
Gene Tiso_gene_9852
- right end position:
- 2903
- transcription direction:
- POSITIVE
- left end position:
- 197
- centisome position:
- 2.1840355
- Synonym(s):
Reactions associated
- Reaction: CARBODEHYDRAT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-5224
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation