Difference between revisions of "R-3-hydroxybehenoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * common name: ** D-glyceraldehyde 3-pho...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxybehenoyl-ACPs R-3-hydroxybehenoyl-ACPs] == * common name: ** a (3R)-3-hydroxybehenoy...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxybehenoyl-ACPs R-3-hydroxybehenoyl-ACPs] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a (3R)-3-hydroxybehenoyl-[acp] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-363]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1G-157]] |
| − | * [[ | + | * [[RXN1G-469]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a (3R)-3-hydroxybehenoyl-[acp]}} | |
| − | + | {{#set: consumed by=RXN1G-363}} | |
| − | + | {{#set: produced by=RXN1G-157|RXN1G-469}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | {{#set: produced by= | + | |
| − | + | ||
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite R-3-hydroxybehenoyl-ACPs
- common name:
- a (3R)-3-hydroxybehenoyl-[acp]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (3R)-3-hydroxybehenoyl-[acp" cannot be used as a page name in this wiki.
