Difference between revisions of "CPD-15530"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.3-RXN 1.3.7.3-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** aldehy...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.3-RXN 1.3.7.3-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.3.7.3 EC-1.3.7.3]
+
** aldehydo-D-glucuronate
 +
* inchi key:
 +
** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
 +
* molecular weight:
 +
** 193.133   
 
* Synonym(s):
 
* Synonym(s):
 +
** aldehydo-D-glucuronic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[1516-DIHYDROBILIVERDIN]][c] '''=>''' 1 [[3Z-PHYCOERYTHROBILIN]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14693]]
−
** 2 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 15,16-dihydrobiliverdin[c] '''=>''' 1 (3Z)-phycoerythrobilin[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
+
* [[GLUCUROISOM-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_17350]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5915]], phycoerythrobilin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5915 PWY-5915]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-7579]], phycourobilin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R05819 R05819]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-1.3.7.3}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953]
−
{{#set: gene associated=Tiso_gene_17350}}
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
−
{{#set: in pathway=PWY-5915|PWY-7579}}
+
{{#set: common name=aldehydo-D-glucuronate}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}}
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: molecular weight=193.133    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=aldehydo-D-glucuronic acid}}
 +
{{#set: reversible reaction associated=RXN-14693|GLUCUROISOM-RXN}}

Latest revision as of 19:42, 21 March 2018

Metabolite CPD-15530

  • smiles:
    • [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
  • common name:
    • aldehydo-D-glucuronate
  • inchi key:
    • InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
  • molecular weight:
    • 193.133
  • Synonym(s):
    • aldehydo-D-glucuronic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15530&oldid=43335"