Difference between revisions of "DTTUP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTTUP DTTUP] == * direction: ** LEFT-TO-RIGHT * common name: ** dTTP:uridine 5'-phosphotransferase...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTTUP DTTUP] ==
* smiles:
+
* direction:
** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** betanidin quinone
+
** dTTP:uridine 5'-phosphotransferase
* inchi key:
+
** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
+
* molecular weight:
+
** 384.301   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-8635]]
+
** 1.0 [[URIDINE]][c] '''+''' 1.0 [[TTP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[UMP]][c] '''+''' 1.0 [[CYTIDINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 uridine[c] '''+''' 1.0 dTTP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 UMP[c] '''+''' 1.0 cytidine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300]
+
{{#set: common name=dTTP:uridine 5'-phosphotransferase}}
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
{{#set: common name=betanidin quinone}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=384.301    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: produced by=RXN-8635}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:44, 21 March 2018

Reaction DTTUP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dTTP:uridine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 uridine[c] + 1.0 dTTP[c] => 1.0 H+[c] + 1.0 UMP[c] + 1.0 cytidine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links