Difference between revisions of "CPD-474"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6587 PWY-6587] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * c...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) |
* common name: | * common name: | ||
| − | ** | + | ** (+)-taxifolin |
| + | * inchi key: | ||
| + | ** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M | ||
| + | * molecular weight: | ||
| + | ** 303.248 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** trans dihydroquercetin | ||
| + | ** (+)-dihydroquercetin | ||
| + | ** taxifolin | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-527]] | |
| − | * [[ | + | * [[RXN-600]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7775]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 480-18-2 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617] | ||
| + | {{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}} | ||
| + | {{#set: common name=(+)-taxifolin}} | ||
| + | {{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}} | ||
| + | {{#set: molecular weight=303.248 }} | ||
| + | {{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}} | ||
| + | {{#set: consumed by=RXN-527|RXN-600}} | ||
| + | {{#set: produced by=RXN-7775}} | ||
Latest revision as of 20:47, 21 March 2018
Contents
Metabolite CPD-474
- smiles:
- C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
- common name:
- (+)-taxifolin
- inchi key:
- InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
- molecular weight:
- 303.248
- Synonym(s):
- trans dihydroquercetin
- (+)-dihydroquercetin
- taxifolin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))" cannot be used as a page name in this wiki.
