Difference between revisions of "PWY66-423"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ALLANTOIN S-ALLANTOIN] == * smiles: ** C1(NC(N)=O)(NC(=O)NC(=O)1) * common name: ** (S)-(+)-a...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-423 PWY66-423] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-423 PWY66-423] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* common name: | * common name: | ||
| − | ** | + | ** fructose 2,6-bisphosphate biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''2''' reactions in the full pathway |
| − | + | * [[3.1.3.46-RXN]] | |
| − | * [[RXN- | + | ** 4 associated gene(s): |
| − | == Reaction(s) | + | *** [[Tiso_gene_15398]] |
| + | *** [[Tiso_gene_892]] | ||
| + | *** [[Tiso_gene_893]] | ||
| + | *** [[Tiso_gene_2100]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[6-PHOSPHOFRUCTO-2-KINASE-RXN]] | ||
| + | ** 5 associated gene(s): | ||
| + | *** [[Tiso_gene_15398]] | ||
| + | *** [[Tiso_gene_804]] | ||
| + | *** [[Tiso_gene_2100]] | ||
| + | *** [[Tiso_gene_893]] | ||
| + | *** [[Tiso_gene_892]] | ||
| + | ** 5 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=fructose 2,6-bisphosphate biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:47, 21 March 2018
Pathway PWY66-423
- taxonomic range:
- common name:
- fructose 2,6-bisphosphate biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- 3.1.3.46-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- 6-PHOSPHOFRUCTO-2-KINASE-RXN
- 5 associated gene(s):
- 5 reconstruction source(s) associated:
