Difference between revisions of "CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-With-N-Terminal-Met Protein-With-N-Terminal-Met] == * common name: ** a peptide with an...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] == * smiles: ** C(OP(=O)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CNC1(C=CC=CC(C(=O)[O-])=1) | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=QKMBYNRMPRKVTO-MNOVXSKESA-K | ||
| + | * molecular weight: | ||
| + | ** 346.21 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-P | ||
| + | ** 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | ||
| + | ** 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose-5-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[IGPSYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PRAISOM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266701 45266701] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58613 58613] | ||
| + | * BIGG : 2cpr5p | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01302 C01302] | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CNC1(C=CC=CC(C(=O)[O-])=1)}} | ||
| + | {{#set: common name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=QKMBYNRMPRKVTO-MNOVXSKESA-K}} | ||
| + | {{#set: molecular weight=346.21 }} | ||
| + | {{#set: common name=1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-P|1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate|1-(2-carboxyphenylamino)-1-deoxy-D-ribulose-5-P}} | ||
| + | {{#set: consumed by=IGPSYN-RXN}} | ||
| + | {{#set: produced by=PRAISOM-RXN}} | ||
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P
- smiles:
- C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CNC1(C=CC=CC(C(=O)[O-])=1)
- common name:
- 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
- inchi key:
- InChIKey=QKMBYNRMPRKVTO-MNOVXSKESA-K
- molecular weight:
- 346.21
- Synonym(s):
- 1-(o-carboxyphenylamino)-1'-deoxyribulose-5'-P
- 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate
- 1-(2-carboxyphenylamino)-1-deoxy-D-ribulose-5-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CNC1(C=CC=CC(C(=O)[O-])=1)" cannot be used as a page name in this wiki.
