Difference between revisions of "PWY-6596"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(5'-met...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596] ==
−
* smiles:
+
* taxonomic range:
−
** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
 
* common name:
 
* common name:
−
** 3-(5'-methylthio)pentylmalate
+
** adenosine nucleotides degradation I
−
* inchi key:
+
−
** InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
+
−
* molecular weight:
+
−
** 248.293   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(5'-methylthio)pentylmalic acid
+
** purine nucleotide catabolism
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXNQT-4171]]
+
'''8''' reactions found over '''8''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[AMP-DEAMINASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
−
* [[RXN-18204]]
+
*** [[Tiso_gene_1778]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6377]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[INOSINE-NUCLEOSIDASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_9396]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-7607]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_6988]]
 +
*** [[Tiso_gene_5911]]
 +
*** [[Tiso_gene_14246]]
 +
*** [[Tiso_gene_13929]]
 +
*** [[Tiso_gene_6640]]
 +
*** [[Tiso_gene_14434]]
 +
*** [[Tiso_gene_14435]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-7682]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_11775]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN0-363]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_11910]]
 +
*** [[Tiso_gene_12995]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN0-901]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_11775]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[XMPXAN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_14435]]
 +
*** [[Tiso_gene_6640]]
 +
*** [[Tiso_gene_14434]]
 +
*** [[Tiso_gene_13929]]
 +
*** [[Tiso_gene_5911]]
 +
*** [[Tiso_gene_14246]]
 +
*** [[Tiso_gene_6988]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3193}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237178 44237178]
+
{{#set: common name=adenosine nucleotides degradation I}}
−
{{#set: smiles=CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: common name=purine nucleotide catabolism}}
−
{{#set: common name=3-(5'-methylthio)pentylmalate}}
+
{{#set: reaction found=8}}
−
{{#set: inchi key=InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L}}
+
{{#set: total reaction=8}}
−
{{#set: molecular weight=248.293    }}
+
{{#set: completion rate=100.0}}
−
{{#set: common name=3-(5'-methylthio)pentylmalic acid}}
+
−
{{#set: consumed by=RXNQT-4171}}
+
−
{{#set: reversible reaction associated=RXN-18204}}
+

Latest revision as of 19:48, 21 March 2018

Pathway PWY-6596

  • taxonomic range:
  • common name:
    • adenosine nucleotides degradation I
  • Synonym(s):
    • purine nucleotide catabolism

Reaction(s) found

8 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6596&oldid=43889"