Difference between revisions of "CPD-4587"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8770 RXN-8770] == * direction: ** LEFT-TO-RIGHT * common name: ** plastid_phosphoglycerate_muta...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4587 CPD-4587] == * smiles: ** COC1(C4(=C(C2([CH]3(CCO[CH](OC(C=1)=2)3)))OC5(C=CC=C(C(C4=O)...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8770 RXN-8770] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4587 CPD-4587] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC1(C4(=C(C2([CH]3(CCO[CH](OC(C=1)=2)3)))OC5(C=CC=C(C(C4=O)=5)O)))
 
* common name:
 
* common name:
−
** plastid_phosphoglycerate_mutase_protein
+
** dihydrosterigmatocystin
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.1.3.73 EC-3.1.3.73]
+
** InChIKey=RHGQIWVTIHZRLI-DCXZOGHSSA-N
 +
* molecular weight:
 +
** 326.305   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ADENOSYLCOBALAMIN-5-P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[ADENOSYLCOBALAMIN]][c]
+
* [[RXN-9500]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 adenosylcobalamin 5'-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 adenosylcobalamin[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_16271]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[COBALSYN-PWY]], adenosylcobalamin salvage from cobinamide I: [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY]
+
−
** '''2''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6269]], adenosylcobalamin salvage from cobinamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-5509]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5509 PWY-5509]
+
−
** '''2''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30370 30370]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21596453 21596453]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* HMDB : HMDB30590
−
{{#set: common name=plastid_phosphoglycerate_mutase_protein}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-3.1.3.73}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C20445 C20445]
−
{{#set: gene associated=Tiso_gene_16271}}
+
* CHEMSPIDER:
−
{{#set: in pathway=COBALSYN-PWY|PWY-6269|PWY-5509}}
+
** [http://www.chemspider.com/Chemical-Structure.4588884.html 4588884]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72677 72677]
−
{{#set: reconstruction tool=pathwaytools}}
+
* METABOLIGHTS : MTBLC72677
 +
{{#set: smiles=COC1(C4(=C(C2([CH]3(CCO[CH](OC(C=1)=2)3)))OC5(C=CC=C(C(C4=O)=5)O)))}}
 +
{{#set: common name=dihydrosterigmatocystin}}
 +
{{#set: inchi key=InChIKey=RHGQIWVTIHZRLI-DCXZOGHSSA-N}}
 +
{{#set: molecular weight=326.305    }}
 +
{{#set: produced by=RXN-9500}}

Latest revision as of 19:48, 21 March 2018

Metabolite CPD-4587

  • smiles:
    • COC1(C4(=C(C2([CH]3(CCO[CH](OC(C=1)=2)3)))OC5(C=CC=C(C(C4=O)=5)O)))
  • common name:
    • dihydrosterigmatocystin
  • inchi key:
    • InChIKey=RHGQIWVTIHZRLI-DCXZOGHSSA-N
  • molecular weight:
    • 326.305
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(C4(=C(C2([CH]3(CCO[CH](OC(C=1)=2)3)))OC5(C=CC=C(C(C4=O)=5)O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4587&oldid=43904"