Difference between revisions of "Tiso gene 7852"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == * smiles: ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O * co...") |
(Created page with "Category:Gene == Gene Tiso_gene_7852 == * right end position: ** 1891 * transcription direction: ** POSITIVE * left end position: ** 161 * centisome position: ** 0.9847697...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7852 == |
− | * | + | * right end position: |
− | ** | + | ** 1891 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 161 |
− | * | + | * centisome position: |
− | ** | + | ** 0.9847697 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ACSERLY-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-12726]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[SULFOCYS-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[HOMOCYSDEGR-PWY]] | ||
+ | * [[CYSTSYN-PWY]] | ||
+ | * [[PWY-801]] | ||
+ | * [[PWY-6936]] | ||
+ | * [[PWY-I9]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1891}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=161}} |
− | {{#set: | + | {{#set: centisome position=0.9847697 }} |
− | {{#set: | + | {{#set: reaction associated=ACSERLY-RXN|CYSTATHIONINE-BETA-SYNTHASE-RXN|RXN-12726|SULFOCYS-RXN}} |
− | {{#set: | + | {{#set: pathway associated=HOMOCYSDEGR-PWY|CYSTSYN-PWY|PWY-801|PWY-6936|PWY-I9}} |
− | {{#set: | + |
Latest revision as of 20:48, 21 March 2018
Gene Tiso_gene_7852
- right end position:
- 1891
- transcription direction:
- POSITIVE
- left end position:
- 161
- centisome position:
- 0.9847697
- Synonym(s):
Reactions associated
- Reaction: ACSERLY-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: CYSTATHIONINE-BETA-SYNTHASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-12726
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: SULFOCYS-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation