Difference between revisions of "PWY-7050"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == * smiles: ** CC(C(SC(CCCCC(N)=O)CCS)=O)C * common name: ** S-(2-methylpropa...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7050 PWY-7050] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33634 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7050 PWY-7050] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33634 TAX-33634] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
| − | ** | + | ** icosapentaenoate biosynthesis IV (bacteria) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** eicosapentaenoate biosynthesis IV (bacteria) |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
| − | + | * [[RXN-13431]] | |
| − | == Reaction(s) | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33634}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=icosapentaenoate biosynthesis IV (bacteria)}} | |
| − | + | {{#set: common name=eicosapentaenoate biosynthesis IV (bacteria)}} | |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: common name= | + | {{#set: total reaction=1}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:48, 21 March 2018
Pathway PWY-7050
- taxonomic range:
- common name:
- icosapentaenoate biosynthesis IV (bacteria)
- Synonym(s):
- eicosapentaenoate biosynthesis IV (bacteria)
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- RXN-13431
- 0 associated gene:
- 1 reconstruction source(s) associated:
