Difference between revisions of "FeS-Cluster-Chaperones-ATP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * common name: ** shikimat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Chaperones-ATP FeS-Cluster-Chaperones-ATP] == * common name: ** an [Fe-S cluster bi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FeS-Cluster-Chaperones-ATP FeS-Cluster-Chaperones-ATP] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an [Fe-S cluster biosynthesis chaperone]-ATP |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14389]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14391]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=an [Fe-S cluster biosynthesis chaperone]-ATP}} | |
| − | + | {{#set: consumed by=RXN-14389}} | |
| − | + | {{#set: produced by=RXN-14391}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: consumed by=RXN- | + | |
| − | {{#set: produced by= | + | |
| − | + | ||
Latest revision as of 20:49, 21 March 2018
Contents
Metabolite FeS-Cluster-Chaperones-ATP
- common name:
- an [Fe-S cluster biosynthesis chaperone]-ATP
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [Fe-S cluster biosynthesis chaperone]-ATP" cannot be used as a page name in this wiki.
