Difference between revisions of "Chlorophyllides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_MN+2 TransportSeed_MN+2] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * smiles: ** C(O)C1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=ZZZCUOFIHG...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_MN+2 TransportSeed_MN+2] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)=C(O)C(=O)O1)
 +
* inchi key:
 +
** InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
 +
* common name:
 +
** dehydro-D-arabinono-1,4-lactone
 +
* molecular weight:
 +
** 146.099   
 
* Synonym(s):
 
* Synonym(s):
 +
** (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
 +
** D-erythro-ascorbic acid
 +
** D-erythro-ascorbate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[MN+2]][e] '''=>''' 1.0 [[MN+2]][c]
+
* [[1.1.3.37-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 Mn2+[e] '''=>''' 1.0 Mn2+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[manual]]:
+
−
** [[added to manage seeds from extracellular to cytosol compartment]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675775 54675775]
−
{{#set: reconstruction category=manual}}
+
* CHEBI:
−
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17803 17803]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06316 C06316]
 +
{{#set: smiles=C(O)C1(C(O)=C(O)C(=O)O1)}}
 +
{{#set: inchi key=InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N}}
 +
{{#set: common name=dehydro-D-arabinono-1,4-lactone}}
 +
{{#set: molecular weight=146.099    }}
 +
{{#set: common name=(5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one|D-erythro-ascorbic acid|D-erythro-ascorbate}}
 +
{{#set: produced by=1.1.3.37-RXN}}

Revision as of 16:26, 10 January 2018

Metabolite CPD-1789

  • smiles:
    • C(O)C1(C(O)=C(O)C(=O)O1)
  • inchi key:
    • InChIKey=ZZZCUOFIHGPKAK-UWTATZPHSA-N
  • common name:
    • dehydro-D-arabinono-1,4-lactone
  • molecular weight:
    • 146.099
  • Synonym(s):
    • (5R)-3,4-dihydroxy-5-(hydroxymethyl)furan-2(5H)-one
    • D-erythro-ascorbic acid
    • D-erythro-ascorbate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Chlorophyllides&oldid=12931"