Difference between revisions of "RXN-12560"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12560 RXN-12560] == * direction: ** REVERSIBLE * common name: ** polyketide_synthase * ec numbe...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12560 RXN-12560] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
 
* common name:
 
* common name:
−
** 18-hydroxyoleoyl-CoA
+
** polyketide_synthase
−
* inchi key:
+
* ec number:
−
** InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J
+
** [http://enzyme.expasy.org/EC/1.1.1.36 EC-1.1.1.36]
−
* molecular weight:
+
−
** 1043.952   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (9Z)-18-hydroxyoctadec-9-enoyl-CoA
 
−
** ω-hydroxyoleoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-16402]]
+
** 1 [[NADP]][c] '''+''' 1 [[CPD-13533]][c] '''<=>''' 1 [[CPD-13534]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADP+[c] '''+''' 1 (R)-3-hydroxyvaleryl-CoA[c] '''<=>''' 1 &beta;-ketovaleryl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5424]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5425]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6562]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6563]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820566 91820566]
+
{{#set: common name=polyketide_synthase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.1.1.36}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86044 86044]
+
{{#set: gene associated=Tiso_gene_5424|Tiso_gene_10876|Tiso_gene_136|Tiso_gene_5425|Tiso_gene_500|Tiso_gene_6562|Tiso_gene_13394|Tiso_gene_135|Tiso_gene_6563}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=}}
−
{{#set: common name=18-hydroxyoleoyl-CoA}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: molecular weight=1043.952    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=(9Z)-18-hydroxyoctadec-9-enoyl-CoA|&omega;-hydroxyoleoyl-CoA}}
+
−
{{#set: produced by=RXN-16402}}
+

Latest revision as of 19:49, 21 March 2018

Reaction RXN-12560

  • direction:
    • REVERSIBLE
  • common name:
    • polyketide_synthase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADP+[c] + 1 (R)-3-hydroxyvaleryl-CoA[c] <=> 1 β-ketovaleryl-CoA[c] + 1 NADPH[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12560&oldid=43990"