Difference between revisions of "AUPT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AUPT AUPT] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:uridine 5'-phosphotransferase * S...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AUPT AUPT] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** α,ω-9Z-octadecenedioate
+
** ATP:uridine 5'-phosphotransferase
−
* inchi key:
+
−
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
+
−
* molecular weight:
+
−
** 310.433   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α,ω-9Z-octadecenedioic acid
 
−
** 1,18-9Z-octadecenedioic acid
 
−
** octadecenedioate
 
−
** 18-carboxyl oleate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16418]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[URIDINE]][c] '''=>''' 1.0 [[UMP]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 ATP[c] '''+''' 1.0 uridine[c] '''=>''' 1.0 UMP[c] '''+''' 1.0 ADP[c] '''+''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
+
{{#set: common name=ATP:uridine 5'-phosphotransferase}}
−
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
{{#set: gene associated=Tiso_gene_14474|Tiso_gene_20134}}
−
{{#set: common name=α,ω-9Z-octadecenedioate}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=310.433    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN-16418}}
+

Latest revision as of 19:50, 21 March 2018

Reaction AUPT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:uridine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 uridine[c] => 1.0 UMP[c] + 1.0 ADP[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=AUPT&oldid=44079"