Difference between revisions of "RXN-8783"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENOL-PHENYLPYRUVATE ENOL-PHENYLPYRUVATE] == * smiles: ** C([O-])(=O)C(O)=CC1(C=CC=CC=1) * commo...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8783 RXN-8783] == * direction: ** LEFT-TO-RIGHT * common name: ** gluconolactonase * ec number:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8783 RXN-8783] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
| − | ** | + | ** gluconolactonase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.1.1.17 EC-3.1.1.17] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[L-GULONO-1-4-LACTONE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[L-GULONATE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 L-gulono-1,4-lactone[c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 L-gulonate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_1948]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_1947]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_15098]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY3DJ-35471]], L-ascorbate biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-35471 PWY3DJ-35471] | ||
| + | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02933 R02933] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=gluconolactonase}} | |
| − | + | {{#set: ec number=EC-3.1.1.17}} | |
| − | + | {{#set: gene associated=Tiso_gene_1948|Tiso_gene_1947|Tiso_gene_15098}} | |
| − | * LIGAND- | + | {{#set: in pathway=PWY3DJ-35471}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=annotation}} |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:50, 21 March 2018
Contents
Reaction RXN-8783
- direction:
- LEFT-TO-RIGHT
- common name:
- gluconolactonase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-GULONO-1-4-LACTONE[c] + 1 WATER[c] => 1 PROTON[c] + 1 L-GULONATE[c]
- With common name(s):
- 1 L-gulono-1,4-lactone[c] + 1 H2O[c] => 1 H+[c] + 1 L-gulonate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_1948
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1947
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_15098
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY3DJ-35471, L-ascorbate biosynthesis IV: PWY3DJ-35471
- 2 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
