Difference between revisions of "CPD0-1081"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GMKALT-RXN GMKALT-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] == * smiles: ** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GMKALT-RXN GMKALT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1081 CPD0-1081] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.7.4.13 EC-2.7.4.13]
+
** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
−
** [http://enzyme.expasy.org/EC/2.7.4.12 EC-2.7.4.12]
+
* inchi key:
 +
** InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
 +
* molecular weight:
 +
** 477.444   
 
* Synonym(s):
 
* Synonym(s):
 +
** glcNAc-1,6-anhMurNAc
 +
** N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-5226]]
−
** 1 [[DGMP]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[DGDP]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 dGMP[c] '''+''' 1 ATP[c] '''=>''' 1 dGDP[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7224]], purine deoxyribonucleosides salvage: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7224 PWY-7224]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12697 12697]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658409 90658409]
−
* LIGAND-RXN:
+
* BIGG : anhgm
−
** [http://www.genome.jp/dbget-bin/www_bget?R02090 R02090]
+
{{#set: smiles=CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate}}
−
{{#set: ec number=EC-2.7.4.13}}
+
{{#set: inchi key=InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M}}
−
{{#set: ec number=EC-2.7.4.12}}
+
{{#set: molecular weight=477.444    }}
−
{{#set: in pathway=PWY-7224}}
+
{{#set: common name=glcNAc-1,6-anhMurNAc|N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN0-5226}}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:51, 21 March 2018

Metabolite CPD0-1081

  • smiles:
    • CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))
  • common name:
    • N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramate
  • inchi key:
    • InChIKey=MWWQKONGFKUAEK-NNRGKNABSA-M
  • molecular weight:
    • 477.444
  • Synonym(s):
    • glcNAc-1,6-anhMurNAc
    • N-acetyl-β-D-glucosamine(anhydrous)-N-acetylmuramic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(=O)[O-])OC2(C(NC(=O)C)C1(OCC(O1)C2OC3(OC(CO)C(O)C(O)C(NC(C)=O)3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD0-1081&oldid=44225"