Difference between revisions of "CPDQT-39"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] == * smiles: ** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-iso...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(6'-me...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19488 CPD-19488] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] ==
 
* smiles:
 
* smiles:
** CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
+
** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 
* common name:
 
* common name:
** 3-isopropyl-9-(methylthio)-2-oxononanoate
+
** 3-(6'-methylthio)hexylmalate
 
* inchi key:
 
* inchi key:
** InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L
+
** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
 
* molecular weight:
 
* molecular weight:
** 260.304    
+
** 262.32    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(6'-methylthio)hexylmalic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18203]]
+
* [[RXNQT-4174]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
* [[RXN-18202]]
 
* [[RXN-18202]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CSCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
+
* PUBCHEM:
{{#set: common name=3-isopropyl-9-(methylthio)-2-oxononanoate}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339]
{{#set: inchi key=InChIKey=PBYOKOGRHHZTHQ-UHFFFAOYSA-L}}
+
{{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
{{#set: molecular weight=260.304   }}
+
{{#set: common name=3-(6'-methylthio)hexylmalate}}
{{#set: consumed by=RXN-18203}}
+
{{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}}
 +
{{#set: molecular weight=262.32   }}
 +
{{#set: common name=3-(6'-methylthio)hexylmalic acid}}
 +
{{#set: consumed by=RXNQT-4174}}
 
{{#set: reversible reaction associated=RXN-18202}}
 
{{#set: reversible reaction associated=RXN-18202}}

Latest revision as of 20:51, 21 March 2018

Metabolite CPDQT-39

  • smiles:
    • CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • common name:
    • 3-(6'-methylthio)hexylmalate
  • inchi key:
    • InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
  • molecular weight:
    • 262.32
  • Synonym(s):
    • 3-(6'-methylthio)hexylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.