Difference between revisions of "2-3-4-Saturated-L-Phosphatidates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(6'-me...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-4-Saturated-L-Phosphatidates 2-3-4-Saturated-L-Phosphatidates] == * common name: ** a 1,2-d...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-4-Saturated-L-Phosphatidates 2-3-4-Saturated-L-Phosphatidates] ==
−
* smiles:
+
−
** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+
 
* common name:
 
* common name:
−
** 3-(6'-methylthio)hexylmalate
+
** a 1,2-diacyl-sn-glycerol 3-phosphate
−
* inchi key:
+
−
** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
+
−
* molecular weight:
+
−
** 262.32   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(6'-methylthio)hexylmalic acid
+
** an L-phosphatidate
 +
** a 3-sn-phosphatidate
 +
** a diacyl-glycerol-3P
 +
** a 2,3,4-saturated L-phosphatidate
 +
** a phosphatidic acid
 +
** a 1,2-diacylglycerol 3-phosphate
 +
** a phosphatidate
 +
** a diacylglycerol 3-phosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXNQT-4174]]
+
* [[RXN0-5515]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5514]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-18202]]
 
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a 1,2-diacyl-sn-glycerol 3-phosphate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339]
+
{{#set: common name=an L-phosphatidate|a 3-sn-phosphatidate|a diacyl-glycerol-3P|a 2,3,4-saturated L-phosphatidate|a phosphatidic acid|a 1,2-diacylglycerol 3-phosphate|a phosphatidate|a diacylglycerol 3-phosphate}}
−
{{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: consumed by=RXN0-5515}}
−
{{#set: common name=3-(6'-methylthio)hexylmalate}}
+
{{#set: produced by=RXN0-5514}}
−
{{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}}
+
−
{{#set: molecular weight=262.32    }}
+
−
{{#set: common name=3-(6'-methylthio)hexylmalic acid}}
+
−
{{#set: consumed by=RXNQT-4174}}
+
−
{{#set: reversible reaction associated=RXN-18202}}
+

Latest revision as of 19:52, 21 March 2018

Metabolite 2-3-4-Saturated-L-Phosphatidates

  • common name:
    • a 1,2-diacyl-sn-glycerol 3-phosphate
  • Synonym(s):
    • an L-phosphatidate
    • a 3-sn-phosphatidate
    • a diacyl-glycerol-3P
    • a 2,3,4-saturated L-phosphatidate
    • a phosphatidic acid
    • a 1,2-diacylglycerol 3-phosphate
    • a phosphatidate
    • a diacylglycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-3-4-Saturated-L-Phosphatidates&oldid=44279"