Difference between revisions of "CMP-KDO"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18492 CPD-18492] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP-KDO CMP-KDO] == * smiles: ** C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP-KDO CMP-KDO] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O) |
* common name: | * common name: | ||
− | ** | + | ** CMP-3-deoxy-β-D-manno-octulosonate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 541.361 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** CMP-2-dehydro-3-deoxy-D-octonate |
+ | ** CMP-Kdo | ||
+ | ** CMP-β-Kdo | ||
+ | ** CMP-ketodeoxyoctonate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[KDOTRANS-RXN]] | ||
+ | * [[KDOTRANS2-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825729 91825729] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85987 85987] |
− | {{#set: smiles= | + | * BIGG : ckdo |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04121 C04121] |
− | {{#set: molecular weight= | + | {{#set: smiles=C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)}} |
− | {{#set: common name= | + | {{#set: common name=CMP-3-deoxy-β-D-manno-octulosonate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L}} |
+ | {{#set: molecular weight=541.361 }} | ||
+ | {{#set: common name=CMP-2-dehydro-3-deoxy-D-octonate|CMP-Kdo|CMP-β-Kdo|CMP-ketodeoxyoctonate}} | ||
+ | {{#set: consumed by=KDOTRANS-RXN|KDOTRANS2-RXN}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite CMP-KDO
- smiles:
- C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)
- common name:
- CMP-3-deoxy-β-D-manno-octulosonate
- inchi key:
- InChIKey=YWWJKULNWGRYAS-XKKDATLGSA-L
- molecular weight:
- 541.361
- Synonym(s):
- CMP-2-dehydro-3-deoxy-D-octonate
- CMP-Kdo
- CMP-β-Kdo
- CMP-ketodeoxyoctonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]3(OC(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)(C([O-])=O)CC(C3O)O)" cannot be used as a page name in this wiki.