Difference between revisions of "CPD-787"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G5DH G5DH] == * direction: ** LEFT-TO-RIGHT * common name: ** glutamate-5-semialdehyde dehydrogenas...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * common name: ** (2Z,4Z)-2-hyd...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=G5DH G5DH] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)CC=CC=C(O)C(=O)[O-]
 
* common name:
 
* common name:
−
** glutamate-5-semialdehyde dehydrogenase
+
** (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate
 +
* inchi key:
 +
** InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L
 +
* molecular weight:
 +
** 170.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate
 +
** HHDD
 +
** (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1K-87]]
−
** 1.0 [[NADPH]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[L-GLUTAMATE-5-P]][c] '''=>''' 1.0 [[L-GLUTAMATE_GAMMA-SEMIALDEHYDE]][c] '''+''' 1.0 [[NADP]][c] '''+''' 1.0 [[Pi]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 NADPH[c] '''+''' 1.0 H+[c] '''+''' 1.0 γ-L-glutamyl 5-phosphate[c] '''=>''' 1.0 L-glutamate-5-semialdehyde[c] '''+''' 1.0 NADP+[c] '''+''' 1.0 phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_16634]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=glutamate-5-semialdehyde dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91828271 91828271]
−
{{#set: gene associated=Tiso_gene_16634}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.11531600.html 11531600]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87504 87504]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05600 C05600]
 +
{{#set: smiles=C([O-])(=O)CC=CC=C(O)C(=O)[O-]}}
 +
{{#set: common name=(2Z,4Z)-2-hydroxyhepta-2,4-dienedioate}}
 +
{{#set: inchi key=InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L}}
 +
{{#set: molecular weight=170.121    }}
 +
{{#set: common name=(2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate|HHDD|(2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate}}
 +
{{#set: consumed by=RXN1K-87}}

Latest revision as of 19:52, 21 March 2018

Metabolite CPD-787

  • smiles:
    • C([O-])(=O)CC=CC=C(O)C(=O)[O-]
  • common name:
    • (2Z,4Z)-2-hydroxyhepta-2,4-dienedioate
  • inchi key:
    • InChIKey=ZBCBETMBSDTINL-NWJCXACMSA-L
  • molecular weight:
    • 170.121
  • Synonym(s):
    • (2Z,4Z)-2-hydroxy-hept-2,4-diene-1,7-dioate
    • HHDD
    • (2Z,4Z)-2-hydroxyhepta-2,4-diene-1,7-dioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)CC=CC=C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-787&oldid=44319"