Difference between revisions of "RXN-14143"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE N-ACETYL-D-GLUCOSAMINE] == * smiles: ** CC(=O)NC1(C(O)OC(CO)C(O)C(O)1) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-methionine biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-methionine biosynthesis via O-phospho-homoserine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | * '''5''' reaction(s) found | |
| − | * [[ | + | ** [[RXN-15131]] |
| − | == Reaction(s) | + | ** [[HOMOSERKIN-RXN]] |
| + | ** [[HOMOCYSMET-RXN]] | ||
| + | ** [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]] | ||
| + | ** [[MMUM-RXN]] | ||
| + | == Reaction(s) not found == | ||
| + | * '''1''' reaction(s) not found | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=CYSPH-RXN CYSPH-RXN] | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-702 PWY-702] | |
| − | + | {{#set: taxonomic range=TAX-3193}} | |
| − | ** [http:// | + | {{#set: common name=L-methionine biosynthesis II}} |
| − | + | {{#set: common name=L-methionine biosynthesis via O-phospho-homoserine}} | |
| − | + | {{#set: reaction found=5}} | |
| − | + | {{#set: reaction not found=1}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 16:26, 10 January 2018
Pathway PWY-702
- taxonomic range:
- common name:
- L-methionine biosynthesis II
- Synonym(s):
- L-methionine biosynthesis via O-phospho-homoserine
Reaction(s) found
- 5 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- ARACYC:
