Difference between revisions of "PWY-7340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7154 PWY-7154] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-30...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7154 PWY-7154] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
* inchi key:
+
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
+
 
* common name:
 
* common name:
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
+
** ergosterol biosynthesis II
* molecular weight:
+
** 443.688   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** ergosterol biosynthesis II (Chlamydomonas)
 +
** ergosterol biosynthesis II (green algae)
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-18]]
+
* '''1''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[CYCLOARTENOL-SYNTHASE-RXN]]
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''7''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13879 RXN-13879]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13884 RXN-13884]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13882 RXN-13882]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13883 RXN-13883]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13880 RXN-13880]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.142-RXN 2.1.1.142-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13881 RXN-13881]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3041}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592]
+
{{#set: common name=ergosterol biosynthesis II}}
* CHEBI:
+
{{#set: common name=ergosterol biosynthesis II (Chlamydomonas)|ergosterol biosynthesis II (green algae)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047]
+
{{#set: reaction found=1}}
* HMDB : HMDB12165
+
{{#set: reaction not found=7}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
+
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=443.688    }}
+
{{#set: consumed by=RXN66-18}}
+

Revision as of 16:26, 10 January 2018

Pathway PWY-7154

  • taxonomic range:
  • common name:
    • ergosterol biosynthesis II
  • Synonym(s):
    • ergosterol biosynthesis II (Chlamydomonas)
    • ergosterol biosynthesis II (green algae)

Reaction(s) found

Reaction(s) not found

External links