Difference between revisions of "CPD-490"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPGPL FPGPL] == * direction: ** REVERSIBLE * common name: ** D-Fructose 1-phosphate D-glyceraldehyd...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == * smiles: ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O * common name: ** α-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-490 CPD-490] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O |
* common name: | * common name: | ||
| − | ** D- | + | ** α-D-xylose 1-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L | ||
| + | * molecular weight: | ||
| + | ** 228.095 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[2.7.7.11-RXN]] | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name=D- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202995 25202995] |
| − | {{#set: | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57559 57559] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03737 C03737] |
| − | + | {{#set: smiles=C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O}} | |
| + | {{#set: common name=α-D-xylose 1-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L}} | ||
| + | {{#set: molecular weight=228.095 }} | ||
| + | {{#set: reversible reaction associated=2.7.7.11-RXN}} | ||
Latest revision as of 20:54, 21 March 2018
Contents
Metabolite CPD-490
- smiles:
- C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O
- common name:
- α-D-xylose 1-phosphate
- inchi key:
- InChIKey=ILXHFXFPPZGENN-KKQCNMDGSA-L
- molecular weight:
- 228.095
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(C(C(CO1)O)O)O)OP([O-])([O-])=O" cannot be used as a page name in this wiki.
